calcitonin-gene-related-peptide-medication The search intent behind "rgd peptide molecular weight" is primarily informational, seeking the specific molecular weight of RGD peptides. The SERP data reveals that "RGD peptide" is a core entity, and its molecular weight can vary depending on the specific sequence and modifications. Common molecular weights cited include 346.Rgd Peptide,CAS No. 99896-85-2, Packaging Type - IndiaMART34 g/mol for the basic Arg-Gly-Asp (RGD) tripeptide and higher values for longer or modified RGD peptides, such as GRGDNP (614.61 g/mol) or cyclic RGD variantsArginylglycylaspartic acid.
The molecular weight of an RGD peptide is not a single, fixed valuePeptide Calculator - Bachem. Instead, it depends on the specific amino acid sequence and any modifications made to the peptide. The RGD (Arginine-Glycine-Aspartic acid) sequence itself is a crucial motif found in many proteins that mediate cell adhesion by binding to integrins, which are receptors on cell surfaces. When discussing the molecular weight of an RGD peptide, it's essential to consider the full peptide sequence and its compositionCatalog Num, A15538. Formula, C12H22N6O6.Molecular Weight, 346.34. CAS Number, 99896-85-2. SMILES, C(CC(C(=O)NCC(=O)NC(CC(=O)O)C(=O)O)N)CN=C(N)N..
The simplest form of an RGD peptide consists of just the three amino acids: Arginine (Arg), Glycine (Gly), and Aspartic acid (Asp). This basic tripeptide, often represented as H-RGD-OH, has a well-defined molecular weight.
* Molecular Weight of H-RGD-OH: Approximately 346.34 g/mol. This value is consistently reported across various sources and represents the foundational molecular weight for an RGD peptide. The molecular formula for this basic tripeptide is C12H22N6O6RGD peptide (GRGDNP) (TFA).
In biological research and therapeutic applications, RGD peptides are often synthesized with additional amino acids or undergo modifications to enhance their properties, such as stability, binding affinity, or targeting capabilities.RGD Peptide - RGD Sequence These additions directly impact the overall molecular weight.
* GRGDNP Peptide: A common RGD peptide used as an integrin inhibitor is GRGDNPPACKING UNIT. price ; Specifications. Fluorophore: ICG. Application: Angiogenesis imaging. Excitation/Emission Max.(nm): 785/821 nm.Molecular weight: 1330.64 g/ .... This sequence includes additional amino acids and often counter-ions like trifluoroacetate (TFA). The molecular weight of the GRGDNP peptide itself is approximately 614.61 g/mol.RGD (Arg-Gly-Asp) Peptides - Integrin Binding Inhibition Variations in purity and counter-ions can lead to slightly different reported molecular weights (e.RGD peptide (GRGDNP) (TFA)g., 728.63 g/mol with TFA).RGD peptideis a synthetic peptide with the sequence GRGDSPK, which binds to integrins (receptor family of extracellular matrix proteins)
* Cyclic RGD Peptides: Cyclic RGD peptides are designed to improve stability and binding affinity...RGD peptidecan inhibit ACK-2 activation through cell adhesion. [4]. Synonyms,RGD Peptides, RGD, Arg-Gly-Asp. Chemical Properties.Molecular Weight, 346.34.. For instance, a cyclic RGD peptide like cyclo (RGDfC) has a molecular weight of approximately 578.7 g/mol. Other cyclic variants, such as cRGD with fluorophore conjugation, can have significantly higher molecular weights, reaching over 1300 g/mol depending on the conjugated moleculeRGD Peptide|Cas# 114681-65-1.
* Extended Sequences and Conjugations: Research often involves more complex RGD-containing molecules, such as RGD peptides conjugated to larger structures like hyperbranched polymers or even larger proteins. In these cases, the molecular weight can range into the thousands or even tens of thousands of g/mol, as seen with RGD-substituted high molecular weight hyperbranched polymers.
Several factors can contribute to slight variations in reported molecular weights:
* Amino Acid Sequence: The specific arrangement and number of amino acids directly determine the peptide's mass.
* Modifications: Post-translational modifications, cyclization, or labeling with tags and fluorophores all add mass.
* Counter-ions: Peptides are often supplied as salts (e.g.beta-Amyloid Peptide (1-40) (human) (AB120479) - Abcam, TFA salts), and the mass of the counter-ion is included in some reported molecular weights.
* Isotopes: While standard molecular weights are calculated using average isotopic masses, high-resolution mass spectrometry can reveal variations due to different isotopic compositionsRAFT polymerization of a RGD peptide-based ....
Understanding the specific sequence and any modifications is crucial when determining the precise molecular weight of an RGD peptide for experimental design, dosage calculations, or material characterization.
Join the newsletter to receive news, updates, new products and freebies in your inbox.